Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
alpha-Bromo-p-toluic acid, 97%
CAS: 6232-88-8 Molecular Formula: C8H7BrO2 Molecular Weight (g/mol): 215.05 MDL Number: MFCD00002567 InChI Key: CQQSQBRPAJSTFB-UHFFFAOYSA-N Synonym: 4-bromomethyl benzoic acid,alpha-bromo-p-toluic acid,benzoic acid, 4-bromomethyl,p-bromomethyl benzoic acid,4-carboxybenzyl bromide,4-bromomethyl-benzoic acid,a-bromo-p-toluic acid,p-carboxybenzyl bromide,p-bromomethylbenzoic acid PubChem CID: 22599 IUPAC Name: 4-(bromomethyl)benzoic acid SMILES: C1=CC(=CC=C1CBr)C(=O)O
| PubChem CID | 22599 |
|---|---|
| CAS | 6232-88-8 |
| Molecular Weight (g/mol) | 215.05 |
| MDL Number | MFCD00002567 |
| SMILES | C1=CC(=CC=C1CBr)C(=O)O |
| Synonym | 4-bromomethyl benzoic acid,alpha-bromo-p-toluic acid,benzoic acid, 4-bromomethyl,p-bromomethyl benzoic acid,4-carboxybenzyl bromide,4-bromomethyl-benzoic acid,a-bromo-p-toluic acid,p-carboxybenzyl bromide,p-bromomethylbenzoic acid |
| IUPAC Name | 4-(bromomethyl)benzoic acid |
| InChI Key | CQQSQBRPAJSTFB-UHFFFAOYSA-N |
| Molecular Formula | C8H7BrO2 |
3-Methyl-1-pentanol, 99+%
CAS: 589-35-5 Molecular Formula: C6H14O Molecular Weight (g/mol): 102.18 MDL Number: MFCD00002937 InChI Key: IWTBVKIGCDZRPL-UHFFFAOYSA-N Synonym: 3-methyl-1-pentanol,3-methylpentanol,1-pentanol, 3-methyl,2-ethyl-4-butanol,3-ethyl-1-butanol,3-ethylbutanol,3-methyl pentanol,fema no. 3762,3-methyl pentan-1-ol,3-methyl-pentan-1-ol PubChem CID: 11508 ChEBI: CHEBI:87381 IUPAC Name: 3-methylpentan-1-ol SMILES: CCC(C)CCO
| PubChem CID | 11508 |
|---|---|
| CAS | 589-35-5 |
| Molecular Weight (g/mol) | 102.18 |
| ChEBI | CHEBI:87381 |
| MDL Number | MFCD00002937 |
| SMILES | CCC(C)CCO |
| Synonym | 3-methyl-1-pentanol,3-methylpentanol,1-pentanol, 3-methyl,2-ethyl-4-butanol,3-ethyl-1-butanol,3-ethylbutanol,3-methyl pentanol,fema no. 3762,3-methyl pentan-1-ol,3-methyl-pentan-1-ol |
| IUPAC Name | 3-methylpentan-1-ol |
| InChI Key | IWTBVKIGCDZRPL-UHFFFAOYSA-N |
| Molecular Formula | C6H14O |
Tetramethylene sulfone, 99+%
CAS: 126-33-0 Molecular Formula: C4H8O2S Molecular Weight (g/mol): 120.17 MDL Number: MFCD00005484 InChI Key: HXJUTPCZVOIRIF-UHFFFAOYSA-N Synonym: sulfolane,tetramethylene sulfone,tetrahydrothiophene 1,1-dioxide,sulfolan,sulpholane,sulfalone,sulphoxaline,1,1-dioxothiolan,dioxothiolan,thiophan sulfone PubChem CID: 31347 ChEBI: CHEBI:74794 IUPAC Name: thiolane 1,1-dioxide SMILES: O=S1(=O)CCCC1
| PubChem CID | 31347 |
|---|---|
| CAS | 126-33-0 |
| Molecular Weight (g/mol) | 120.17 |
| ChEBI | CHEBI:74794 |
| MDL Number | MFCD00005484 |
| SMILES | O=S1(=O)CCCC1 |
| Synonym | sulfolane,tetramethylene sulfone,tetrahydrothiophene 1,1-dioxide,sulfolan,sulpholane,sulfalone,sulphoxaline,1,1-dioxothiolan,dioxothiolan,thiophan sulfone |
| IUPAC Name | thiolane 1,1-dioxide |
| InChI Key | HXJUTPCZVOIRIF-UHFFFAOYSA-N |
| Molecular Formula | C4H8O2S |
n-Decane, 99%
CAS: 124-18-5 Molecular Formula: C10H22 Molecular Weight (g/mol): 142.286 MDL Number: MFCD00008954 InChI Key: DIOQZVSQGTUSAI-UHFFFAOYSA-N Synonym: n-decane,nonane, methyl,decyl hydride,unii-nk85062oiy,ccris 653,hsdb 63,dsstox_cid_4913,decane, analytical standard,dsstox_rid_77577,dsstox_gsid_24913 PubChem CID: 15600 ChEBI: CHEBI:41808 IUPAC Name: decane SMILES: CCCCCCCCCC
| PubChem CID | 15600 |
|---|---|
| CAS | 124-18-5 |
| Molecular Weight (g/mol) | 142.286 |
| ChEBI | CHEBI:41808 |
| MDL Number | MFCD00008954 |
| SMILES | CCCCCCCCCC |
| Synonym | n-decane,nonane, methyl,decyl hydride,unii-nk85062oiy,ccris 653,hsdb 63,dsstox_cid_4913,decane, analytical standard,dsstox_rid_77577,dsstox_gsid_24913 |
| IUPAC Name | decane |
| InChI Key | DIOQZVSQGTUSAI-UHFFFAOYSA-N |
| Molecular Formula | C10H22 |
2-Fluorophenacyl bromide, 98%
CAS: 655-15-2 Molecular Formula: C8H6BrFO Molecular Weight (g/mol): 217.04 InChI Key: QDNWNJSLWKHNTM-UHFFFAOYSA-N Synonym: 2-bromo-2'-fluoroacetophenone,2-bromo-1-2-fluorophenyl ethanone,2-fluorophenacyl bromide,2-bromo-1-2-fluorophenyl ethan-1-one,alpha-bromo-2-fluoroacetophenone,2-fluorophenacylbromide,ethanone, 2-bromo-1-2-fluorophenyl,o-fluorophenacyl bromide,omega-bromo-2-fluoroacetophenone,2-bromo-1-2'-fluorophenyl ethanone PubChem CID: 2737449 IUPAC Name: 2-bromo-1-(2-fluorophenyl)ethanone SMILES: C1=CC=C(C(=C1)C(=O)CBr)F
| PubChem CID | 2737449 |
|---|---|
| CAS | 655-15-2 |
| Molecular Weight (g/mol) | 217.04 |
| SMILES | C1=CC=C(C(=C1)C(=O)CBr)F |
| Synonym | 2-bromo-2'-fluoroacetophenone,2-bromo-1-2-fluorophenyl ethanone,2-fluorophenacyl bromide,2-bromo-1-2-fluorophenyl ethan-1-one,alpha-bromo-2-fluoroacetophenone,2-fluorophenacylbromide,ethanone, 2-bromo-1-2-fluorophenyl,o-fluorophenacyl bromide,omega-bromo-2-fluoroacetophenone,2-bromo-1-2'-fluorophenyl ethanone |
| IUPAC Name | 2-bromo-1-(2-fluorophenyl)ethanone |
| InChI Key | QDNWNJSLWKHNTM-UHFFFAOYSA-N |
| Molecular Formula | C8H6BrFO |
4-Methoxyphenethyl alcohol, 96%
CAS: 702-23-8 Molecular Formula: C9H12O2 Molecular Weight (g/mol): 152.19 MDL Number: MFCD00002900 InChI Key: AUWDOZOUJWEPBA-UHFFFAOYSA-N Synonym: 2-4-methoxyphenyl ethanol,4-methoxyphenethyl alcohol,4-methoxybenzeneethanol,benzeneethanol, 4-methoxy,p-methoxyphenethyl alcohol,2-4-methoxyphenyl ethan-1-ol,unii-3mwl5nze9k,3mwl5nze9k,4-2-hydroxyethyl anisole,2-4-methoxyphenyl-ethanol PubChem CID: 69705 IUPAC Name: 2-(4-methoxyphenyl)ethanol SMILES: COC1=CC=C(C=C1)CCO
| PubChem CID | 69705 |
|---|---|
| CAS | 702-23-8 |
| Molecular Weight (g/mol) | 152.19 |
| MDL Number | MFCD00002900 |
| SMILES | COC1=CC=C(C=C1)CCO |
| Synonym | 2-4-methoxyphenyl ethanol,4-methoxyphenethyl alcohol,4-methoxybenzeneethanol,benzeneethanol, 4-methoxy,p-methoxyphenethyl alcohol,2-4-methoxyphenyl ethan-1-ol,unii-3mwl5nze9k,3mwl5nze9k,4-2-hydroxyethyl anisole,2-4-methoxyphenyl-ethanol |
| IUPAC Name | 2-(4-methoxyphenyl)ethanol |
| InChI Key | AUWDOZOUJWEPBA-UHFFFAOYSA-N |
| Molecular Formula | C9H12O2 |
delta-Valerolactam, 99%
CAS: 675-20-7 Molecular Formula: C5H9NO Molecular Weight (g/mol): 99.13 MDL Number: MFCD00006037 InChI Key: XUWHAWMETYGRKB-UHFFFAOYSA-N Synonym: 2-piperidone,2-piperidinone,delta-valerolactam,valerolactim,5-pentanolactam,piperidinone,piperidon,piperidone,alpha-piperidone,piperidone-2 PubChem CID: 12665 ChEBI: CHEBI:77761 IUPAC Name: piperidin-2-one SMILES: O=C1CCCCN1
| PubChem CID | 12665 |
|---|---|
| CAS | 675-20-7 |
| Molecular Weight (g/mol) | 99.13 |
| ChEBI | CHEBI:77761 |
| MDL Number | MFCD00006037 |
| SMILES | O=C1CCCCN1 |
| Synonym | 2-piperidone,2-piperidinone,delta-valerolactam,valerolactim,5-pentanolactam,piperidinone,piperidon,piperidone,alpha-piperidone,piperidone-2 |
| IUPAC Name | piperidin-2-one |
| InChI Key | XUWHAWMETYGRKB-UHFFFAOYSA-N |
| Molecular Formula | C5H9NO |
3,5-Lutidine, 98+%
CAS: 591-22-0 Molecular Formula: C7H9N Molecular Weight (g/mol): 107.15 MDL Number: MFCD00006404 InChI Key: HWWYDZCSSYKIAD-UHFFFAOYSA-N Synonym: 3,5-lutidine,pyridine, 3,5-dimethyl,unii-6q4ypz045v,3,5-dimethyl pyridine,3,5 lutidine,3,5-lutdcine,3,5-dimethylpyridin,3,5-dimethyl-pyridine,acmc-1axev,dsstox_cid_30825 PubChem CID: 11565 IUPAC Name: 3,5-dimethylpyridine SMILES: CC1=CC(=CN=C1)C
| PubChem CID | 11565 |
|---|---|
| CAS | 591-22-0 |
| Molecular Weight (g/mol) | 107.15 |
| MDL Number | MFCD00006404 |
| SMILES | CC1=CC(=CN=C1)C |
| Synonym | 3,5-lutidine,pyridine, 3,5-dimethyl,unii-6q4ypz045v,3,5-dimethyl pyridine,3,5 lutidine,3,5-lutdcine,3,5-dimethylpyridin,3,5-dimethyl-pyridine,acmc-1axev,dsstox_cid_30825 |
| IUPAC Name | 3,5-dimethylpyridine |
| InChI Key | HWWYDZCSSYKIAD-UHFFFAOYSA-N |
| Molecular Formula | C7H9N |
Dotriacontane, 97%
CAS: 544-85-4 Molecular Formula: C32H66 Molecular Weight (g/mol): 450.88 MDL Number: MFCD00009411 InChI Key: QHMGJGNTMQDRQA-UHFFFAOYSA-N Synonym: n-dotriacontane,bicetyl,unii-7ksv90rn23,dicetyl,lacceran,dotriacontane, n,dotriacontane,acmc-1akq8,4-01-00-00595 beilstein handbook reference,wln: 32h PubChem CID: 11008 ChEBI: CHEBI:36020 IUPAC Name: dotriacontane SMILES: CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC
| PubChem CID | 11008 |
|---|---|
| CAS | 544-85-4 |
| Molecular Weight (g/mol) | 450.88 |
| ChEBI | CHEBI:36020 |
| MDL Number | MFCD00009411 |
| SMILES | CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC |
| Synonym | n-dotriacontane,bicetyl,unii-7ksv90rn23,dicetyl,lacceran,dotriacontane, n,dotriacontane,acmc-1akq8,4-01-00-00595 beilstein handbook reference,wln: 32h |
| IUPAC Name | dotriacontane |
| InChI Key | QHMGJGNTMQDRQA-UHFFFAOYSA-N |
| Molecular Formula | C32H66 |
Diphenylmethane, 99%
CAS: 101-81-5 Molecular Formula: C13H12 Molecular Weight (g/mol): 168.24 MDL Number: MFCD00004781 InChI Key: CZZYITDELCSZES-UHFFFAOYSA-N Synonym: diphenylmethane,ditan,ditane,benzene, 1,1'-methylenebis,diphenyl methane,benzene, benzyl,methane, diphenyl,1,1'-dimethylenebis benzene,benzene, phenylmethyl,methylenedibenzene PubChem CID: 7580 ChEBI: CHEBI:38884 IUPAC Name: benzylbenzene SMILES: C(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 7580 |
|---|---|
| CAS | 101-81-5 |
| Molecular Weight (g/mol) | 168.24 |
| ChEBI | CHEBI:38884 |
| MDL Number | MFCD00004781 |
| SMILES | C(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | diphenylmethane,ditan,ditane,benzene, 1,1'-methylenebis,diphenyl methane,benzene, benzyl,methane, diphenyl,1,1'-dimethylenebis benzene,benzene, phenylmethyl,methylenedibenzene |
| IUPAC Name | benzylbenzene |
| InChI Key | CZZYITDELCSZES-UHFFFAOYSA-N |
| Molecular Formula | C13H12 |
Methyl cyanoacetate, 97%
CAS: 105-34-0 Molecular Formula: C4H5NO2 Molecular Weight (g/mol): 99.09 MDL Number: MFCD00001939 InChI Key: ANGDWNBGPBMQHW-UHFFFAOYSA-N Synonym: methyl cyanoacetate,cyanoacetic acid methyl ester,methyl cyanoethanoate,acetic acid, cyano-, methyl ester,usaf kf-22,methylester kyseliny kyanoctove,methylcyanoacetate,malonic methyl ester nitrile,acetic acid, 2-cyano-, methyl ester,methyl cyano acetate PubChem CID: 7747 ChEBI: CHEBI:51928 IUPAC Name: methyl 2-cyanoacetate SMILES: COC(=O)CC#N
| PubChem CID | 7747 |
|---|---|
| CAS | 105-34-0 |
| Molecular Weight (g/mol) | 99.09 |
| ChEBI | CHEBI:51928 |
| MDL Number | MFCD00001939 |
| SMILES | COC(=O)CC#N |
| Synonym | methyl cyanoacetate,cyanoacetic acid methyl ester,methyl cyanoethanoate,acetic acid, cyano-, methyl ester,usaf kf-22,methylester kyseliny kyanoctove,methylcyanoacetate,malonic methyl ester nitrile,acetic acid, 2-cyano-, methyl ester,methyl cyano acetate |
| IUPAC Name | methyl 2-cyanoacetate |
| InChI Key | ANGDWNBGPBMQHW-UHFFFAOYSA-N |
| Molecular Formula | C4H5NO2 |
Methyl acetate, 99%
CAS: 79-20-9 Molecular Formula: C3H6O2 Molecular Weight (g/mol): 74.079 MDL Number: MFCD00008711 InChI Key: KXKVLQRXCPHEJC-UHFFFAOYSA-N Synonym: tereton,devoton,acetic acid, methyl ester,methyl ethanoate,acetic acid methyl ester,methylacetat,acetate de methyle,methylacetaat,methyl acetic ester,octan metylu PubChem CID: 6584 ChEBI: CHEBI:77700 IUPAC Name: methyl acetate SMILES: CC(=O)OC
| PubChem CID | 6584 |
|---|---|
| CAS | 79-20-9 |
| Molecular Weight (g/mol) | 74.079 |
| ChEBI | CHEBI:77700 |
| MDL Number | MFCD00008711 |
| SMILES | CC(=O)OC |
| Synonym | tereton,devoton,acetic acid, methyl ester,methyl ethanoate,acetic acid methyl ester,methylacetat,acetate de methyle,methylacetaat,methyl acetic ester,octan metylu |
| IUPAC Name | methyl acetate |
| InChI Key | KXKVLQRXCPHEJC-UHFFFAOYSA-N |
| Molecular Formula | C3H6O2 |
Ethylenediaminetetraacetic acid disodium salt dihydrate, 99+%
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 IUPAC Name: disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| IUPAC Name | disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
4-(4-Ethoxyphenylazo)-m-phenylenediamine, mixture of mono and dihydrochloride, 98%
CAS: 74367-87-6 Molecular Formula: C14H16N4O·xHCl Molecular Weight (g/mol): 256.3 MDL Number: MFCD00042023 Synonym: ethoxazene hydrochloride,ethoxazene hcl,4-4-ethoxyphenylazo-m-phenylenediamine monohydrochloride,etoxazene hydrochloride,ethoxy red,unii-5c90pjn6e5,ethoxazene hydrochloride usan,4-4-ethoxyphenyl diazenyl benzene-1,3-diamine hydrochloride,4-4-ethoxyphenylazo-1,3-phenylenediamine monohydrochloride,1,3-benzenediamine, 4-4-ethoxyphenyl azo-, monohydrochloride
| CAS | 74367-87-6 |
|---|---|
| Molecular Weight (g/mol) | 256.3 |
| MDL Number | MFCD00042023 |
| Synonym | ethoxazene hydrochloride,ethoxazene hcl,4-4-ethoxyphenylazo-m-phenylenediamine monohydrochloride,etoxazene hydrochloride,ethoxy red,unii-5c90pjn6e5,ethoxazene hydrochloride usan,4-4-ethoxyphenyl diazenyl benzene-1,3-diamine hydrochloride,4-4-ethoxyphenylazo-1,3-phenylenediamine monohydrochloride,1,3-benzenediamine, 4-4-ethoxyphenyl azo-, monohydrochloride |
| Molecular Formula | C14H16N4O·xHCl |
5-Bromo-6-chloro-2-picoline, 98+%, Thermo Scientific Chemicals
CAS: 185017-72-5 Molecular Formula: C6H5BrClN Molecular Weight (g/mol): 206.47 MDL Number: MFCD03095218 InChI Key: JVDQYSIJBRTRMS-UHFFFAOYSA-N Synonym: 3-bromo-2-chloro-6-picoline,5-bromo-6-chloro-2-picoline,2-chloro-3-bromo-6-methylpyridine,5-bromo-6-chloro-2-methylpyridine,pyridine, 3-bromo-2-chloro-6-methyl,3-bromo-2-chloro-6-methyl-pyridine,pubchem1286,acmc-209emg,ksc538q8t,3-bromo-2-chloro-6 picoline PubChem CID: 2734418 IUPAC Name: 3-bromo-2-chloro-6-methylpyridine SMILES: CC1=CC=C(Br)C(Cl)=N1
| PubChem CID | 2734418 |
|---|---|
| CAS | 185017-72-5 |
| Molecular Weight (g/mol) | 206.47 |
| MDL Number | MFCD03095218 |
| SMILES | CC1=CC=C(Br)C(Cl)=N1 |
| Synonym | 3-bromo-2-chloro-6-picoline,5-bromo-6-chloro-2-picoline,2-chloro-3-bromo-6-methylpyridine,5-bromo-6-chloro-2-methylpyridine,pyridine, 3-bromo-2-chloro-6-methyl,3-bromo-2-chloro-6-methyl-pyridine,pubchem1286,acmc-209emg,ksc538q8t,3-bromo-2-chloro-6 picoline |
| IUPAC Name | 3-bromo-2-chloro-6-methylpyridine |
| InChI Key | JVDQYSIJBRTRMS-UHFFFAOYSA-N |
| Molecular Formula | C6H5BrClN |